C18H26N2O6 — CID 154916847
(3,4-dimethoxyphenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid (PubChem CID 154916847) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid.
| Compound Name | (3,4-dimethoxyphenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154916847 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
| SMILES | COc1ccc(C(=O)N2C[C@@H]3COC[C@H](C2)N(C)C3)cc1OC.O=CO |
| InChI | InChI=1S/C17H24N2O4.CH2O2/c1-18-7-12-8-19(9-14(18)11-23-10-12)17(20)13-4-5-15(21-2)16(6-13)22-3;2-1-3/h4-6,12,14H,7-11H2,1-3H3;1H,(H,2,3)/t12-,14+;/m1./s1 |
| InChIKey | DQZDTFZJPCBYMI-OJMBIDBESA-N |
| XLogP | 0.81 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|