C20H30N2O6 — CID 154918249
[3-(2-ethoxyethoxy)phenyl]-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid (PubChem CID 154918249) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is [3-(2-ethoxyethoxy)phenyl]-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid.
| Compound Name | [3-(2-ethoxyethoxy)phenyl]-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154918249 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [3-(2-ethoxyethoxy)phenyl]-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
| SMILES | CCOCCOc1cccc(C(=O)N2C[C@@H]3COC[C@H](C2)N(C)C3)c1.O=CO |
| InChI | InChI=1S/C19H28N2O4.CH2O2/c1-3-23-7-8-25-18-6-4-5-16(9-18)19(22)21-11-15-10-20(2)17(12-21)14-24-13-15;2-1-3/h4-6,9,15,17H,3,7-8,10-14H2,1-2H3;1H,(H,2,3)/t15-,17+;/m1./s1 |
| InChIKey | UTXUHNKWDQWPMO-KALLACGZSA-N |
| XLogP | 1.21 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|