C11H14F2N2 — CID 134585716
(1S)-2-(3,3-difluoroazetidin-1-yl)-1-phenylethanamine (PubChem CID 134585716) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1S)-2-(3,3-difluoroazetidin-1-yl)-1-phenylethanamine.
| Compound Name | (1S)-2-(3,3-difluoroazetidin-1-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 134585716 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (1S)-2-(3,3-difluoroazetidin-1-yl)-1-phenylethanamine |
| SMILES | N[C@H](CN1CC(F)(F)C1)c1ccccc1 |
| InChI | InChI=1S/C11H14F2N2/c12-11(13)7-15(8-11)6-10(14)9-4-2-1-3-5-9/h1-5,10H,6-8,14H2/t10-/m1/s1 |
| InChIKey | BTQHCHOOUOPAPI-SNVBAGLBSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |