C23H19F7N4O5S — CID 134586572
[[4-[[2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methylamino]-2,6-difluorophenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino] 2,2,2-trifluoroacetate (PubChem CID 134586572) has the molecular formula C23H19F7N4O5S and a molecular weight of 596.48 g/mol. Its IUPAC name is [[4-[[2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methylamino]-2,6-difluorophenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino] 2,2,2-trifluoroacetate.
| Compound Name | [[4-[[2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methylamino]-2,6-difluorophenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134586572 |
| Molecular Formula | C23H19F7N4O5S |
| Molecular Weight | 596.48 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | [[4-[[2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methylamino]-2,6-difluorophenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)amino] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(N(OC(=O)C(F)(F)F)S(=O)(=O)c2c(F)cc(NCc3c(F)ccc(F)c3CN3CCC3)cc2F)no1 |
| InChI | InChI=1S/C23H19F7N4O5S/c1-12-7-20(32-38-12)34(39-22(35)23(28,29)30)40(36,37)21-18(26)8-13(9-19(21)27)31-10-14-15(11-33-5-2-6-33)17(25)4-3-16(14)24/h3-4,7-9,31H,2,5-6,10-11H2,1H3 |
| InChIKey | YDBHSGHEQOAHPH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|