C21H21ClN2O5S — CID 134589314
3-amino-5-(3-chlorophenoxy)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 134589314) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is 3-amino-5-(3-chlorophenoxy)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-5-(3-chlorophenoxy)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134589314 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-amino-5-(3-chlorophenoxy)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(N)cc(Oc3cccc(Cl)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C21H21ClN2O5S/c1-27-17-7-6-14(21(12-17)28-2)13-24-30(25,26)20-10-16(23)9-19(11-20)29-18-5-3-4-15(22)8-18/h3-12,24H,13,23H2,1-2H3 |
| InChIKey | NLAHGCGEFTVLRQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|