C16H14N4O3 — CID 134589387
2-methoxy-5-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzoic acid (PubChem CID 134589387) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-methoxy-5-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzoic acid.
| Compound Name | 2-methoxy-5-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 134589387 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-methoxy-5-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzoic acid |
| SMILES | COc1ccc(Nc2ncn(-c3ccccc3)n2)cc1C(=O)O |
| InChI | InChI=1S/C16H14N4O3/c1-23-14-8-7-11(9-13(14)15(21)22)18-16-17-10-20(19-16)12-5-3-2-4-6-12/h2-10H,1H3,(H,18,19)(H,21,22) |
| InChIKey | AVAQOXYBXDQWTD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |