C19H20N4O2 — CID 134589468
N-[3-methoxy-4-[(3R)-oxolan-3-yl]phenyl]-1-phenyl-1,2,4-triazol-3-amine (PubChem CID 134589468) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[3-methoxy-4-[(3R)-oxolan-3-yl]phenyl]-1-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-[3-methoxy-4-[(3R)-oxolan-3-yl]phenyl]-1-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589468 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[3-methoxy-4-[(3R)-oxolan-3-yl]phenyl]-1-phenyl-1,2,4-triazol-3-amine |
| SMILES | COc1cc(Nc2ncn(-c3ccccc3)n2)ccc1[C@H]1CCOC1 |
| InChI | InChI=1S/C19H20N4O2/c1-24-18-11-15(7-8-17(18)14-9-10-25-12-14)21-19-20-13-23(22-19)16-5-3-2-4-6-16/h2-8,11,13-14H,9-10,12H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | OACMRWXWJQCIFU-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |