C19H19N5O3 — CID 134589815
2-methoxy-N-(oxetan-3-yl)-4-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzamide (PubChem CID 134589815) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-methoxy-N-(oxetan-3-yl)-4-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzamide.
| Compound Name | 2-methoxy-N-(oxetan-3-yl)-4-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 134589815 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-methoxy-N-(oxetan-3-yl)-4-[(1-phenyl-1,2,4-triazol-3-yl)amino]benzamide |
| SMILES | COc1cc(Nc2ncn(-c3ccccc3)n2)ccc1C(=O)NC1COC1 |
| InChI | InChI=1S/C19H19N5O3/c1-26-17-9-13(7-8-16(17)18(25)21-14-10-27-11-14)22-19-20-12-24(23-19)15-5-3-2-4-6-15/h2-9,12,14H,10-11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | JLFNPWNUJBVSPS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |