C16H8F6N4O2 — CID 134589674
1-(3,5-difluorophenyl)-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-amine (PubChem CID 134589674) has the molecular formula C16H8F6N4O2 and a molecular weight of 402.25 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589674 |
| Molecular Formula | C16H8F6N4O2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-amine |
| SMILES | Fc1cc(F)cc(-n2cnc(Nc3ccc4c(c3)OC(F)(F)C(F)(F)O4)n2)c1 |
| InChI | InChI=1S/C16H8F6N4O2/c17-8-3-9(18)5-11(4-8)26-7-23-14(25-26)24-10-1-2-12-13(6-10)28-16(21,22)15(19,20)27-12/h1-7H,(H,24,25) |
| InChIKey | CYPFWIMBMLEQIO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|