C16H14F2N4O — CID 134589675
1-(3,5-difluorophenyl)-N-(3-ethoxyphenyl)-1,2,4-triazol-3-amine (PubChem CID 134589675) has the molecular formula C16H14F2N4O and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-(3-ethoxyphenyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-(3-ethoxyphenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589675 |
| Molecular Formula | C16H14F2N4O |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-(3-ethoxyphenyl)-1,2,4-triazol-3-amine |
| SMILES | CCOc1cccc(Nc2ncn(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C16H14F2N4O/c1-2-23-15-5-3-4-13(9-15)20-16-19-10-22(21-16)14-7-11(17)6-12(18)8-14/h3-10H,2H2,1H3,(H,20,21) |
| InChIKey | DGMWMUWFRTVEMH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |