C12H14N2O — CID 134591507
1-(3-cyclopropyl-5-methyl-2-pyridinyl)azetidin-3-one (PubChem CID 134591507) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(3-cyclopropyl-5-methyl-2-pyridinyl)azetidin-3-one.
| Compound Name | 1-(3-cyclopropyl-5-methyl-2-pyridinyl)azetidin-3-one |
|---|---|
| PubChem CID | 134591507 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(3-cyclopropyl-5-methyl-2-pyridinyl)azetidin-3-one |
| SMILES | Cc1cnc(N2CC(=O)C2)c(C2CC2)c1 |
| InChI | InChI=1S/C12H14N2O/c1-8-4-11(9-2-3-9)12(13-5-8)14-6-10(15)7-14/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | WIFMDAPJTDLFRV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |