C14H21N — CID 58667168
2,5-dimethyl-3-[(2R)-2-methylcyclohexyl]pyridine (PubChem CID 58667168) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2,5-dimethyl-3-[(2R)-2-methylcyclohexyl]pyridine.
| Compound Name | 2,5-dimethyl-3-[(2R)-2-methylcyclohexyl]pyridine |
|---|---|
| PubChem CID | 58667168 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2,5-dimethyl-3-[(2R)-2-methylcyclohexyl]pyridine |
| SMILES | Cc1cnc(C)c(C2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C14H21N/c1-10-8-14(12(3)15-9-10)13-7-5-4-6-11(13)2/h8-9,11,13H,4-7H2,1-3H3/t11-,13?/m1/s1 |
| InChIKey | NYNANCNTRFVFAW-JTDNENJMSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |