About 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene
9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene (PubChem CID 123526388) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene.
Analyze 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The IUPAC name of 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene (CID 123526388) is 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene.
What is the SMILES notation for 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The canonical SMILES for 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene is Cc1cnc2c(c1)C1CC1N2.
What is the InChIKey of 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The InChIKey is FGMDKKVTUGNEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-5-2-7-6-3-8(6)11-9(7)10-4-5/h2,4,6,8H,3H2,1H3,(H,10,11).
What are the key properties of 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene has a molecular weight of 146.19 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene is sourced from PubChem (CID 123526388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).