C19H15N3O — CID 134593682
3-(3-methylphenyl)-5-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole (PubChem CID 134593682) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(3-methylphenyl)-5-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-methylphenyl)-5-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 134593682 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(3-methylphenyl)-5-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2noc(-c3ccc(-n4cccc4)cc3)n2)c1 |
| InChI | InChI=1S/C19H15N3O/c1-14-5-4-6-16(13-14)18-20-19(23-21-18)15-7-9-17(10-8-15)22-11-2-3-12-22/h2-13H,1H3 |
| InChIKey | DBVIEIOLYXDMSI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|