C20H17N3O2 — CID 4916212
5-(4-ethoxyphenyl)-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole (PubChem CID 4916212) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-ethoxyphenyl)-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 4916212 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-(4-ethoxyphenyl)-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole |
| SMILES | CCOc1ccc(-c2nc(-c3ccc(-n4cccc4)cc3)no2)cc1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-24-18-11-7-16(8-12-18)20-21-19(22-25-20)15-5-9-17(10-6-15)23-13-3-4-14-23/h3-14H,2H2,1H3 |
| InChIKey | AJDIKOQIHQXXBC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|