C22H16O2S — CID 134594148
2,5-bis(2-ethynyl-4-methoxyphenyl)thiophene (PubChem CID 134594148) has the molecular formula C22H16O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2,5-bis(2-ethynyl-4-methoxyphenyl)thiophene.
| Compound Name | 2,5-bis(2-ethynyl-4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 134594148 |
| Molecular Formula | C22H16O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2,5-bis(2-ethynyl-4-methoxyphenyl)thiophene |
| SMILES | C#Cc1cc(OC)ccc1-c1ccc(-c2ccc(OC)cc2C#C)s1 |
| InChI | InChI=1S/C22H16O2S/c1-5-15-13-17(23-3)7-9-19(15)21-11-12-22(25-21)20-10-8-18(24-4)14-16(20)6-2/h1-2,7-14H,3-4H3 |
| InChIKey | QEHUZDOCOZQPMU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|