C29H31ClN6O3S — CID 134594410
2-[4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-3-yl]acetonitrile (PubChem CID 134594410) has the molecular formula C29H31ClN6O3S and a molecular weight of 579.13 g/mol. Its IUPAC name is 2-[4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-3-yl]acetonitrile.
| Compound Name | 2-[4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 134594410 |
| Molecular Formula | C29H31ClN6O3S |
| Molecular Weight | 579.13 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 2-[4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-3-yl]acetonitrile |
| SMILES | COc1cc2c(Nc3ccc(Sc4nccn4C)c(Cl)c3)c(CC#N)cnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C29H31ClN6O3S/c1-35-10-8-32-29(35)40-27-5-4-21(16-23(27)30)34-28-20(6-7-31)19-33-24-18-26(25(37-2)17-22(24)28)39-13-3-9-36-11-14-38-15-12-36/h4-5,8,10,16-19H,3,6,9,11-15H2,1-2H3,(H,33,34) |
| InChIKey | GNTFOKYZUUUMSX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.13 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|