C22H18ClF3N4O4S2 — CID 58965319
[4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-3-methylquinolin-7-yl] trifluoromethanesulfonate (PubChem CID 58965319) has the molecular formula C22H18ClF3N4O4S2 and a molecular weight of 558.99 g/mol. Its IUPAC name is [4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-3-methylquinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-3-methylquinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58965319 |
| Molecular Formula | C22H18ClF3N4O4S2 |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | [4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-6-methoxy-3-methylquinolin-7-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(Nc3ccc(Sc4nccn4C)c(Cl)c3)c(C)cnc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H18ClF3N4O4S2/c1-12-11-28-16-10-18(34-36(31,32)22(24,25)26)17(33-3)9-14(16)20(12)29-13-4-5-19(15(23)8-13)35-21-27-6-7-30(21)2/h4-11H,1-3H3,(H,28,29) |
| InChIKey | WWCPIEYUCUCJDT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|