C49H31F2N5 — CID 134595982
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine (PubChem CID 134595982) has the molecular formula C49H31F2N5 and a molecular weight of 727.82 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 134595982 |
| Molecular Formula | C49H31F2N5 |
| Molecular Weight | 727.82 g/mol |
| Exact Mass | 727.25 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccc(F)cc3)nc3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c2c(C)c2c(-c3ccc(F)cc3)nc3ccccc3c12 |
| InChI | InChI=1S/C49H31F2N5/c1-28-41-37-15-9-10-16-39(37)52-45(30-17-22-35(50)23-18-30)43(41)29(2)42-38-26-21-34(27-40(38)53-46(44(28)42)31-19-24-36(51)25-20-31)49-55-47(32-11-5-3-6-12-32)54-48(56-49)33-13-7-4-8-14-33/h3-27H,1-2H3 |
| InChIKey | MRHLEZIHBRSDOS-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.82 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|