C56H41N2OP — CID 134596151
3-[9-methyl-7-[(9-methyl-9-phenyl-7-pyridin-3-ylfluoren-2-yl)-phenylphosphoryl]-9-phenylfluoren-2-yl]pyridine (PubChem CID 134596151) has the molecular formula C56H41N2OP and a molecular weight of 788.93 g/mol. Its IUPAC name is 3-[9-methyl-7-[(9-methyl-9-phenyl-7-pyridin-3-ylfluoren-2-yl)-phenylphosphoryl]-9-phenylfluoren-2-yl]pyridine.
| Compound Name | 3-[9-methyl-7-[(9-methyl-9-phenyl-7-pyridin-3-ylfluoren-2-yl)-phenylphosphoryl]-9-phenylfluoren-2-yl]pyridine |
|---|---|
| PubChem CID | 134596151 |
| Molecular Formula | C56H41N2OP |
| Molecular Weight | 788.93 g/mol |
| Exact Mass | 788.30 |
| IUPAC Name | 3-[9-methyl-7-[(9-methyl-9-phenyl-7-pyridin-3-ylfluoren-2-yl)-phenylphosphoryl]-9-phenylfluoren-2-yl]pyridine |
| SMILES | CC1(c2ccccc2)c2cc(-c3cccnc3)ccc2-c2ccc(P(=O)(c3ccccc3)c3ccc4c(c3)C(C)(c3ccccc3)c3cc(-c5cccnc5)ccc3-4)cc21 |
| InChI | InChI=1S/C56H41N2OP/c1-55(42-16-6-3-7-17-42)51-32-38(40-14-12-30-57-36-40)22-26-47(51)49-28-24-45(34-53(49)55)60(59,44-20-10-5-11-21-44)46-25-29-50-48-27-23-39(41-15-13-31-58-37-41)33-52(48)56(2,54(50)35-46)43-18-8-4-9-19-43/h3-37H,1-2H3 |
| InChIKey | CFLOBSGIYYMFSY-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.93 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|