C20H21FN4O2 — CID 134596314
N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-4-phenyloxane-4-carboxamide (PubChem CID 134596314) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 134596314 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-4-phenyloxane-4-carboxamide |
| SMILES | NC(/C=C\Nc1ccnc(F)c1)=N\C(=O)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C20H21FN4O2/c21-17-14-16(6-10-24-17)23-11-7-18(22)25-19(26)20(8-12-27-13-9-20)15-4-2-1-3-5-15/h1-7,10-11,14H,8-9,12-13H2,(H,23,24)(H2,22,25,26)/b11-7- |
| InChIKey | RHEIVQYVRHWOCB-XFFZJAGNSA-N |
| XLogP | 2.78 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|