C18H16F2N4O — CID 142372068
N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-1-(3-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 142372068) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-1-(3-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-1-(3-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142372068 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[(Z)-1-amino-3-[(2-fluoro-4-pyridinyl)amino]prop-2-enylidene]-1-(3-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(/C=C\Nc1ccnc(F)c1)=N\C(=O)C1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H16F2N4O/c19-13-3-1-2-12(10-13)18(6-7-18)17(25)24-16(21)5-9-22-14-4-8-23-15(20)11-14/h1-5,8-11H,6-7H2,(H,22,23)(H2,21,24,25)/b9-5- |
| InChIKey | XYCJPGCRGLJYBG-UITAMQMPSA-N |
| XLogP | 2.90 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|