C12H12F2N4O — CID 142372088
N-[(Z)-1-amino-3-(pyridin-4-ylamino)prop-2-enylidene]-2,2-difluorocyclopropane-1-carboxamide (PubChem CID 142372088) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(pyridin-4-ylamino)prop-2-enylidene]-2,2-difluorocyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(pyridin-4-ylamino)prop-2-enylidene]-2,2-difluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142372088 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | N-[(Z)-1-amino-3-(pyridin-4-ylamino)prop-2-enylidene]-2,2-difluorocyclopropane-1-carboxamide |
| SMILES | NC(/C=C\Nc1ccncc1)=N\C(=O)C1CC1(F)F |
| InChI | InChI=1S/C12H12F2N4O/c13-12(14)7-9(12)11(19)18-10(15)3-6-17-8-1-4-16-5-2-8/h1-6,9H,7H2,(H,16,17)(H2,15,18,19)/b6-3- |
| InChIKey | JGVFIIIERHAFFN-UTCJRWHESA-N |
| XLogP | 1.55 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|