C18H15FN4O — CID 134596485
N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 134596485) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134596485 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccn(-c2ccnc(F)c2)n1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H15FN4O/c19-15-12-14(6-10-20-15)23-11-7-16(22-23)21-17(24)18(8-9-18)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2,(H,21,22,24) |
| InChIKey | OJFXJNRQEOUNKC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|