C18H14F2N4O — CID 134596195
1-(4-fluorophenyl)-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]cyclopropane-1-carboxamide (PubChem CID 134596195) has the molecular formula C18H14F2N4O and a molecular weight of 340.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134596195 |
| Molecular Formula | C18H14F2N4O |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccn(-c2ccnc(F)c2)n1)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H14F2N4O/c19-13-3-1-12(2-4-13)18(7-8-18)17(25)22-16-6-10-24(23-16)14-5-9-21-15(20)11-14/h1-6,9-11H,7-8H2,(H,22,23,25) |
| InChIKey | NMAIMJJHHZMBIX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|