C21H19FN4O — CID 140905836
N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylspiro[2.3]hexane-2-carboxamide (PubChem CID 140905836) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylspiro[2.3]hexane-2-carboxamide.
| Compound Name | N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylspiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 140905836 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylspiro[2.3]hexane-2-carboxamide |
| SMILES | O=C(Nc1ccn(-c2ccnc(F)c2)n1)C1(c2ccccc2)CC12CCC2 |
| InChI | InChI=1S/C21H19FN4O/c22-17-13-16(7-11-23-17)26-12-8-18(25-26)24-19(27)21(14-20(21)9-4-10-20)15-5-2-1-3-6-15/h1-3,5-8,11-13H,4,9-10,14H2,(H,24,25,27) |
| InChIKey | OZDHOYVVNVEOIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|