C18H13Cl2FN4O — CID 134589233
(1S)-2,2-dichloro-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 134589233) has the molecular formula C18H13Cl2FN4O and a molecular weight of 391.23 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134589233 |
| Molecular Formula | C18H13Cl2FN4O |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (1S)-2,2-dichloro-N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccn(-c2ccnc(F)c2)n1)[C@@]1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C18H13Cl2FN4O/c19-18(20)11-17(18,12-4-2-1-3-5-12)16(26)23-15-7-9-25(24-15)13-6-8-22-14(21)10-13/h1-10H,11H2,(H,23,24,26)/t17-/m0/s1 |
| InChIKey | KUPUXSWUVHEAOG-KRWDZBQOSA-N |
| XLogP | 3.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|