C14H19N5O3S — CID 134598594
[4-[6-(aminomethyl)-2-(dimethylamino)pyrimidin-4-yl]oxyphenyl]methanesulfonamide (PubChem CID 134598594) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is [4-[6-(aminomethyl)-2-(dimethylamino)pyrimidin-4-yl]oxyphenyl]methanesulfonamide.
| Compound Name | [4-[6-(aminomethyl)-2-(dimethylamino)pyrimidin-4-yl]oxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 134598594 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [4-[6-(aminomethyl)-2-(dimethylamino)pyrimidin-4-yl]oxyphenyl]methanesulfonamide |
| SMILES | CN(C)c1nc(CN)cc(Oc2ccc(CS(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C14H19N5O3S/c1-19(2)14-17-11(8-15)7-13(18-14)22-12-5-3-10(4-6-12)9-23(16,20)21/h3-7H,8-9,15H2,1-2H3,(H2,16,20,21) |
| InChIKey | BGTQOFMPBKZYGK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |