C25H24F4N4O4 — CID 134598991
(2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3,5-difluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide (PubChem CID 134598991) has the molecular formula C25H24F4N4O4 and a molecular weight of 520.48 g/mol. Its IUPAC name is (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3,5-difluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide.
| Compound Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3,5-difluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
|---|---|
| PubChem CID | 134598991 |
| Molecular Formula | C25H24F4N4O4 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3,5-difluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3cc(F)c(C)c(F)c3)n3c2C[C@H]2C[C@H]23)CC(F)(F)C1 |
| InChI | InChI=1S/C25H24F4N4O4/c1-10-14(26)6-13(7-15(10)27)31-21(35)19-11(2)18(17-5-12-4-16(12)33(17)19)20(34)22(36)32-24(23(37)30-3)8-25(28,29)9-24/h6-7,12,16H,4-5,8-9H2,1-3H3,(H,30,37)(H,31,35)(H,32,36)/t12-,16-/m1/s1 |
| InChIKey | SGJFFQITSNOTLD-MLGOLLRUSA-N |
| XLogP | 2.97 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|