C35H43N3O4 — CID 134599405
[2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl 3-ethyloctanoate (PubChem CID 134599405) has the molecular formula C35H43N3O4 and a molecular weight of 569.75 g/mol. Its IUPAC name is [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl 3-ethyloctanoate.
| Compound Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl 3-ethyloctanoate |
|---|---|
| PubChem CID | 134599405 |
| Molecular Formula | C35H43N3O4 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl 3-ethyloctanoate |
| SMILES | CCCCCC(CC)CC(=O)OCn1c(=O)oc2c(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)cccc21 |
| InChI | InChI=1S/C35H43N3O4/c1-3-5-7-12-27(4-2)24-33(39)41-26-38-32-18-11-17-31(34(32)42-35(38)40)37-21-19-36(20-22-37)25-28-13-10-16-30(23-28)29-14-8-6-9-15-29/h6,8-11,13-18,23,27H,3-5,7,12,19-22,24-26H2,1-2H3 |
| InChIKey | RRPABJQAKTUXMA-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|