C16H24FNOS — CID 134602217
(1S)-N-(tert-butylsulfinylmethyl)-1-(5-cyclopropyl-2-fluorophenyl)ethanamine (PubChem CID 134602217) has the molecular formula C16H24FNOS and a molecular weight of 297.44 g/mol. Its IUPAC name is (1S)-N-(tert-butylsulfinylmethyl)-1-(5-cyclopropyl-2-fluorophenyl)ethanamine.
| Compound Name | (1S)-N-(tert-butylsulfinylmethyl)-1-(5-cyclopropyl-2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 134602217 |
| Molecular Formula | C16H24FNOS |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (1S)-N-(tert-butylsulfinylmethyl)-1-(5-cyclopropyl-2-fluorophenyl)ethanamine |
| SMILES | C[C@H](NCS(=O)C(C)(C)C)c1cc(C2CC2)ccc1F |
| InChI | InChI=1S/C16H24FNOS/c1-11(18-10-20(19)16(2,3)4)14-9-13(12-5-6-12)7-8-15(14)17/h7-9,11-12,18H,5-6,10H2,1-4H3/t11-,20?/m0/s1 |
| InChIKey | HFRVEQIRXSJSRX-ZOZMEPSFSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |