C17H13F3N2O2S — CID 134602568
N-[(4-methoxyphenyl)methyl]-N-(2,4,6-trifluorophenyl)sulfanyl-1,2-oxazol-3-amine (PubChem CID 134602568) has the molecular formula C17H13F3N2O2S and a molecular weight of 366.36 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-(2,4,6-trifluorophenyl)sulfanyl-1,2-oxazol-3-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-(2,4,6-trifluorophenyl)sulfanyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 134602568 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-(2,4,6-trifluorophenyl)sulfanyl-1,2-oxazol-3-amine |
| SMILES | COc1ccc(CN(Sc2c(F)cc(F)cc2F)c2ccon2)cc1 |
| InChI | InChI=1S/C17H13F3N2O2S/c1-23-13-4-2-11(3-5-13)10-22(16-6-7-24-21-16)25-17-14(19)8-12(18)9-15(17)20/h2-9H,10H2,1H3 |
| InChIKey | AJSZHAZBYGJFIJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|