C10H9F2NO2S — CID 134602897
4-acetyl-2,6-difluoro-N-methylsulfanylbenzamide (PubChem CID 134602897) has the molecular formula C10H9F2NO2S and a molecular weight of 245.25 g/mol. Its IUPAC name is 4-acetyl-2,6-difluoro-N-methylsulfanylbenzamide.
| Compound Name | 4-acetyl-2,6-difluoro-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 134602897 |
| Molecular Formula | C10H9F2NO2S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 4-acetyl-2,6-difluoro-N-methylsulfanylbenzamide |
| SMILES | CSNC(=O)c1c(F)cc(C(C)=O)cc1F |
| InChI | InChI=1S/C10H9F2NO2S/c1-5(14)6-3-7(11)9(8(12)4-6)10(15)13-16-2/h3-4H,1-2H3,(H,13,15) |
| InChIKey | NUXXWVOAJZPZIX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|