C26H48NO9P — CID 134604808
7-O-[2-(2-oxopyrrolidin-1-yl)ethyl] 1-O-(2-phosphonooxyethyl) 6-tert-butyl-2,2,3,3,4,4,6-heptamethylheptanedioate (PubChem CID 134604808) has the molecular formula C26H48NO9P and a molecular weight of 549.64 g/mol. Its IUPAC name is 7-O-[2-(2-oxopyrrolidin-1-yl)ethyl] 1-O-(2-phosphonooxyethyl) 6-tert-butyl-2,2,3,3,4,4,6-heptamethylheptanedioate.
| Compound Name | 7-O-[2-(2-oxopyrrolidin-1-yl)ethyl] 1-O-(2-phosphonooxyethyl) 6-tert-butyl-2,2,3,3,4,4,6-heptamethylheptanedioate |
|---|---|
| PubChem CID | 134604808 |
| Molecular Formula | C26H48NO9P |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 7-O-[2-(2-oxopyrrolidin-1-yl)ethyl] 1-O-(2-phosphonooxyethyl) 6-tert-butyl-2,2,3,3,4,4,6-heptamethylheptanedioate |
| SMILES | CC(C)(C)C(C)(CC(C)(C)C(C)(C)C(C)(C)C(=O)OCCOP(=O)(O)O)C(=O)OCCN1CCCC1=O |
| InChI | InChI=1S/C26H48NO9P/c1-22(2,3)26(10,21(30)34-15-14-27-13-11-12-19(27)28)18-23(4,5)25(8,9)24(6,7)20(29)35-16-17-36-37(31,32)33/h11-18H2,1-10H3,(H2,31,32,33) |
| InChIKey | QAJFQAIQTJXHLH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|