C18H13FINO3S2 — CID 134605558
(5R)-5-fluoro-2-iodo-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline (PubChem CID 134605558) has the molecular formula C18H13FINO3S2 and a molecular weight of 501.34 g/mol. Its IUPAC name is (5R)-5-fluoro-2-iodo-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline.
| Compound Name | (5R)-5-fluoro-2-iodo-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 134605558 |
| Molecular Formula | C18H13FINO3S2 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 500.94 |
| IUPAC Name | (5R)-5-fluoro-2-iodo-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline |
| SMILES | COc1ccc(S(=O)(=O)N2c3cc(I)sc3-c3ccccc3[C@H]2F)cc1 |
| InChI | InChI=1S/C18H13FINO3S2/c1-24-11-6-8-12(9-7-11)26(22,23)21-15-10-16(20)25-17(15)13-4-2-3-5-14(13)18(21)19/h2-10,18H,1H3/t18-/m0/s1 |
| InChIKey | ZJFFTKQEZMKWBH-SFHVURJKSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|