C20H19NO3S2 — CID 68579644
5-ethyl-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline (PubChem CID 68579644) has the molecular formula C20H19NO3S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 5-ethyl-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline.
| Compound Name | 5-ethyl-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 68579644 |
| Molecular Formula | C20H19NO3S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-ethyl-4-(4-methoxyphenyl)sulfonyl-5H-thieno[3,2-c]isoquinoline |
| SMILES | CCC1c2ccccc2-c2sccc2N1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19NO3S2/c1-3-18-16-6-4-5-7-17(16)20-19(12-13-25-20)21(18)26(22,23)15-10-8-14(24-2)9-11-15/h4-13,18H,3H2,1-2H3 |
| InChIKey | STZUQMVSZHHQAI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |