C27H28FNO4S — CID 22482317
[4-[(6-ethyl-8-fluoro-6H-phenanthridin-5-yl)sulfonyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 22482317) has the molecular formula C27H28FNO4S and a molecular weight of 481.59 g/mol. Its IUPAC name is [4-[(6-ethyl-8-fluoro-6H-phenanthridin-5-yl)sulfonyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[(6-ethyl-8-fluoro-6H-phenanthridin-5-yl)sulfonyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 22482317 |
| Molecular Formula | C27H28FNO4S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [4-[(6-ethyl-8-fluoro-6H-phenanthridin-5-yl)sulfonyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | CCC1c2cc(F)ccc2-c2ccccc2N1S(=O)(=O)c1ccc(OC(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H28FNO4S/c1-5-24-23-16-18(28)10-15-21(23)22-8-6-7-9-25(22)29(24)34(31,32)20-13-11-19(12-14-20)33-26(30)17-27(2,3)4/h6-16,24H,5,17H2,1-4H3 |
| InChIKey | DFJVZJOGGJZAGG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|