C21H17F2NO3S — CID 22482344
3,9-difluoro-5-(4-methoxyphenyl)sulfonyl-6-methyl-6H-phenanthridine (PubChem CID 22482344) has the molecular formula C21H17F2NO3S and a molecular weight of 401.43 g/mol. Its IUPAC name is 3,9-difluoro-5-(4-methoxyphenyl)sulfonyl-6-methyl-6H-phenanthridine.
| Compound Name | 3,9-difluoro-5-(4-methoxyphenyl)sulfonyl-6-methyl-6H-phenanthridine |
|---|---|
| PubChem CID | 22482344 |
| Molecular Formula | C21H17F2NO3S |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3,9-difluoro-5-(4-methoxyphenyl)sulfonyl-6-methyl-6H-phenanthridine |
| SMILES | COc1ccc(S(=O)(=O)N2c3cc(F)ccc3-c3cc(F)ccc3C2C)cc1 |
| InChI | InChI=1S/C21H17F2NO3S/c1-13-18-9-3-14(22)11-20(18)19-10-4-15(23)12-21(19)24(13)28(25,26)17-7-5-16(27-2)6-8-17/h3-13H,1-2H3 |
| InChIKey | OQWFHXIAPVZBMI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |