C24H24FN3O3S2 — CID 17262758
1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 17262758) has the molecular formula C24H24FN3O3S2 and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17262758 |
| Molecular Formula | C24H24FN3O3S2 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3c4ccc(F)cc4CCC3C)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3O3S2/c1-16-3-4-17-15-18(25)5-14-23(17)28(16)33(29,30)22-12-8-20(9-13-22)27-24(32)26-19-6-10-21(31-2)11-7-19/h5-16H,3-4H2,1-2H3,(H2,26,27,32) |
| InChIKey | VLLRQAWMMUYRLV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|