C24H24FN3O2S2 — CID 25237642
1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methylphenyl)thiourea (PubChem CID 25237642) has the molecular formula C24H24FN3O2S2 and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 25237642 |
| Molecular Formula | C24H24FN3O2S2 |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 1-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3c4ccc(F)cc4CCC3C)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3O2S2/c1-16-3-8-20(9-4-16)26-24(31)27-21-10-12-22(13-11-21)32(29,30)28-17(2)5-6-18-15-19(25)7-14-23(18)28/h3-4,7-15,17H,5-6H2,1-2H3,(H2,26,27,31) |
| InChIKey | AKYFSKMDDKQHEA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|