C25H26FN3O2S2 — CID 25237648
1-(3,4-dimethylphenyl)-3-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]thiourea (PubChem CID 25237648) has the molecular formula C25H26FN3O2S2 and a molecular weight of 483.63 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25237648 |
| Molecular Formula | C25H26FN3O2S2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]phenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3c4ccc(F)cc4CCC3C)cc2)cc1C |
| InChI | InChI=1S/C25H26FN3O2S2/c1-16-4-8-22(14-17(16)2)28-25(32)27-21-9-11-23(12-10-21)33(30,31)29-18(3)5-6-19-15-20(26)7-13-24(19)29/h4,7-15,18H,5-6H2,1-3H3,(H2,27,28,32) |
| InChIKey | GJDREDZKNYPGOD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|