About 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol
4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol (PubChem CID 11494467) has the molecular formula C19H17NO3S2
and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol.
Molecular Properties
| Compound Name | 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol |
| PubChem CID | 11494467 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol |
| SMILES | CCC1c2ccccc2-c2sccc2N1S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H17NO3S2/c1-2-17-15-5-3-4-6-16(15)19-18(11-12-24-19)20(17)25(22,23)14-9-7-13(21)8-10-14/h3-12,17,21H,2H2,1H3 |
| InChIKey | OIQMJACKZIMXDB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol?
The IUPAC name of 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol (CID 11494467) is 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol.
What is the SMILES notation for 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol?
The canonical SMILES for 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol is CCC1c2ccccc2-c2sccc2N1S(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol?
The InChIKey is OIQMJACKZIMXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3S2/c1-2-17-15-5-3-4-6-16(15)19-18(11-12-24-19)20(17)25(22,23)14-9-7-13(21)8-10-14/h3-12,17,21H,2H2,1H3.
What are the key properties of 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol?
4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol has a molecular weight of 371.48 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-ethyl-5H-thieno[3,2-c]isoquinolin-4-yl)sulfonyl]phenol is sourced from PubChem (CID 11494467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).