C13H16F2N2O3S — CID 134608514
5-(difluoromethyl)-4-[[(2-oxoazepan-3-yl)amino]methyl]thiophene-3-carboxylic acid (PubChem CID 134608514) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-(difluoromethyl)-4-[[(2-oxoazepan-3-yl)amino]methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-4-[[(2-oxoazepan-3-yl)amino]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 134608514 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5-(difluoromethyl)-4-[[(2-oxoazepan-3-yl)amino]methyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(C(F)F)c1CNC1CCCCNC1=O |
| InChI | InChI=1S/C13H16F2N2O3S/c14-11(15)10-7(8(6-21-10)13(19)20)5-17-9-3-1-2-4-16-12(9)18/h6,9,11,17H,1-5H2,(H,16,18)(H,19,20) |
| InChIKey | RXEABZZFMWZQGI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |