C18H17F4N3O2 — CID 134610620
4-[2-fluoro-6-(trifluoromethyl)benzoyl]-N-piperidin-4-yl-1H-pyrrole-2-carboxamide (PubChem CID 134610620) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is 4-[2-fluoro-6-(trifluoromethyl)benzoyl]-N-piperidin-4-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[2-fluoro-6-(trifluoromethyl)benzoyl]-N-piperidin-4-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610620 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[2-fluoro-6-(trifluoromethyl)benzoyl]-N-piperidin-4-yl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cc(C(=O)c2c(F)cccc2C(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C18H17F4N3O2/c19-13-3-1-2-12(18(20,21)22)15(13)16(26)10-8-14(24-9-10)17(27)25-11-4-6-23-7-5-11/h1-3,8-9,11,23-24H,4-7H2,(H,25,27) |
| InChIKey | ZMIYWUGFVJNKIS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |