C17H10BrF2N3O2 — CID 134610622
4-(2-bromo-6-fluorobenzoyl)-N-(6-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide (PubChem CID 134610622) has the molecular formula C17H10BrF2N3O2 and a molecular weight of 406.19 g/mol. Its IUPAC name is 4-(2-bromo-6-fluorobenzoyl)-N-(6-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(2-bromo-6-fluorobenzoyl)-N-(6-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610622 |
| Molecular Formula | C17H10BrF2N3O2 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 4-(2-bromo-6-fluorobenzoyl)-N-(6-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1)c1cc(C(=O)c2c(F)cccc2Br)c[nH]1 |
| InChI | InChI=1S/C17H10BrF2N3O2/c18-11-2-1-3-12(19)15(11)16(24)9-6-13(21-7-9)17(25)23-10-4-5-14(20)22-8-10/h1-8,21H,(H,23,25) |
| InChIKey | BORKQXVAHJDAOY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|