C22H20Cl2FN5O2 — CID 145044251
4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(piperidin-4-ylamino)-3-pyridinyl]-1H-pyrrole-2-carboxamide (PubChem CID 145044251) has the molecular formula C22H20Cl2FN5O2 and a molecular weight of 476.34 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(piperidin-4-ylamino)-3-pyridinyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(piperidin-4-ylamino)-3-pyridinyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 145044251 |
| Molecular Formula | C22H20Cl2FN5O2 |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(piperidin-4-ylamino)-3-pyridinyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC2CCNCC2)nc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C22H20Cl2FN5O2/c23-15-2-3-16(24)20(25)19(15)21(31)12-9-17(27-10-12)22(32)30-14-1-4-18(28-11-14)29-13-5-7-26-8-6-13/h1-4,9-11,13,26-27H,5-8H2,(H,28,29)(H,30,32) |
| InChIKey | IELUKJNLNIYNGC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|