C23H23Cl2FN6O2 — CID 134610650
4-(3,6-dichloro-2-fluorobenzoyl)-N-[2-(2-piperidin-1-ylethylamino)pyrimidin-5-yl]-1H-pyrrole-2-carboxamide (PubChem CID 134610650) has the molecular formula C23H23Cl2FN6O2 and a molecular weight of 505.38 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[2-(2-piperidin-1-ylethylamino)pyrimidin-5-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[2-(2-piperidin-1-ylethylamino)pyrimidin-5-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610650 |
| Molecular Formula | C23H23Cl2FN6O2 |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[2-(2-piperidin-1-ylethylamino)pyrimidin-5-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cnc(NCCN2CCCCC2)nc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C23H23Cl2FN6O2/c24-16-4-5-17(25)20(26)19(16)21(33)14-10-18(28-11-14)22(34)31-15-12-29-23(30-13-15)27-6-9-32-7-2-1-3-8-32/h4-5,10-13,28H,1-3,6-9H2,(H,31,34)(H,27,29,30) |
| InChIKey | FDFXDRXOKSIEAA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|