C21H17Cl2FN6O4 — CID 118959017
4-[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]piperazine-1-carboxylic acid (PubChem CID 118959017) has the molecular formula C21H17Cl2FN6O4 and a molecular weight of 507.31 g/mol. Its IUPAC name is 4-[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 118959017 |
| Molecular Formula | C21H17Cl2FN6O4 |
| Molecular Weight | 507.31 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 4-[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]piperazine-1-carboxylic acid |
| SMILES | O=C(Nc1cnc(N2CCN(C(=O)O)CC2)nc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C21H17Cl2FN6O4/c22-13-1-2-14(23)17(24)16(13)18(31)11-7-15(25-8-11)19(32)28-12-9-26-20(27-10-12)29-3-5-30(6-4-29)21(33)34/h1-2,7-10,25H,3-6H2,(H,28,32)(H,33,34) |
| InChIKey | KJNRFXGFGGJQRK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|