C21H14Cl2FN5O2 — CID 134610326
4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(pyridin-3-ylmethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 134610326) has the molecular formula C21H14Cl2FN5O2 and a molecular weight of 458.28 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(pyridin-3-ylmethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(pyridin-3-ylmethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610326 |
| Molecular Formula | C21H14Cl2FN5O2 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(pyridin-3-ylmethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2cccnc2)c1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C21H14Cl2FN5O2/c22-15-3-4-16(23)19(24)18(15)20(30)13-6-17(26-8-13)21(31)28-14-9-27-29(11-14)10-12-2-1-5-25-7-12/h1-9,11,26H,10H2,(H,28,31) |
| InChIKey | SBJBXWLGEYIWKY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|