C18H15Cl2FN4O4S — CID 118959050
4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 118959050) has the molecular formula C18H15Cl2FN4O4S and a molecular weight of 473.31 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118959050 |
| Molecular Formula | C18H15Cl2FN4O4S |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | CS(=O)(=O)CCn1cc(NC(=O)c2cc(C(=O)c3c(Cl)ccc(Cl)c3F)c[nH]2)cn1 |
| InChI | InChI=1S/C18H15Cl2FN4O4S/c1-30(28,29)5-4-25-9-11(8-23-25)24-18(27)14-6-10(7-22-14)17(26)15-12(19)2-3-13(20)16(15)21/h2-3,6-9,22H,4-5H2,1H3,(H,24,27) |
| InChIKey | UGPAKGXRZYZQSY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|